C32H59N11 — CID 173456620
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7-triamine (PubChem CID 173456620) has the molecular formula C32H59N11 and a molecular weight of 597.90 g/mol. Its IUPAC name is 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7-triamine.
| Compound Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7-triamine |
|---|---|
| PubChem CID | 173456620 |
| Molecular Formula | C32H59N11 |
| Molecular Weight | 597.90 g/mol |
| Exact Mass | 597.50 |
| IUPAC Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane-5,6,7-triamine |
| SMILES | NC1CC2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C(N)C1N)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C32H59N11/c33-21-13-20-22(24(35)23(21)34)32-42-30-19-12-6-5-11-18(19)28(40-30)38-26-15-8-2-1-7-14(15)25(36-26)37-27-16-9-3-4-10-17(16)29(39-27)41-31(20)43-32/h14-32,36-43H,1-13,33-35H2 |
| InChIKey | CMDDAEOPEBRXIK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 174.30 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.90 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |