C23H43NaO6 — CID 173456832
sodium;hydride;1-O-methyl 4-O-[(Z)-octadec-9-enyl] 2,3-dihydroxybutanedioate (PubChem CID 173456832) has the molecular formula C23H43NaO6 and a molecular weight of 438.58 g/mol. Its IUPAC name is sodium;hydride;1-O-methyl 4-O-[(Z)-octadec-9-enyl] 2,3-dihydroxybutanedioate.
| Compound Name | sodium;hydride;1-O-methyl 4-O-[(Z)-octadec-9-enyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 173456832 |
| Molecular Formula | C23H43NaO6 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | sodium;hydride;1-O-methyl 4-O-[(Z)-octadec-9-enyl] 2,3-dihydroxybutanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)C(O)C(O)C(=O)OC.[H-].[Na+] |
| InChI | InChI=1S/C23H42O6.Na.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-29-23(27)21(25)20(24)22(26)28-2;;/h10-11,20-21,24-25H,3-9,12-19H2,1-2H3;;/q;+1;-1/b11-10-;; |
| InChIKey | CARQQUQMNXARCL-PQBRBDCOSA-N |
| XLogP | 1.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|