C18H26ClNO3 — CID 173458738
(6R,13S,16R,17R)-6-amino-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;hydrochloride (PubChem CID 173458738) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is (6R,13S,16R,17R)-6-amino-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;hydrochloride.
| Compound Name | (6R,13S,16R,17R)-6-amino-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;hydrochloride |
|---|---|
| PubChem CID | 173458738 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (6R,13S,16R,17R)-6-amino-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol;hydrochloride |
| SMILES | C[C@]12CCC3c4ccc(O)cc4[C@H](N)CC3C1C[C@@H](O)[C@@H]2O.Cl |
| InChI | InChI=1S/C18H25NO3.ClH/c1-18-5-4-11-10-3-2-9(20)6-13(10)15(19)7-12(11)14(18)8-16(21)17(18)22;/h2-3,6,11-12,14-17,20-22H,4-5,7-8,19H2,1H3;1H/t11?,12?,14?,15-,16-,17+,18+;/m1./s1 |
| InChIKey | RPTHGQORJLLEIZ-DNTPOEBQSA-N |
| XLogP | 2.46 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |