About amino(trimethyl)azanium;ethyl(trimethyl)azanium
amino(trimethyl)azanium;ethyl(trimethyl)azanium (PubChem CID 173458972) has the molecular formula C8H25N3+2
and a molecular weight of 163.31 g/mol. Its IUPAC name is amino(trimethyl)azanium;ethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | amino(trimethyl)azanium;ethyl(trimethyl)azanium |
| PubChem CID | 173458972 |
| Molecular Formula | C8H25N3+2 |
| Molecular Weight | 163.31 g/mol |
| Exact Mass | 163.20 |
| IUPAC Name | amino(trimethyl)azanium;ethyl(trimethyl)azanium |
| SMILES | CC[N+](C)(C)C.C[N+](C)(C)N |
| InChI | InChI=1S/C5H14N.C3H11N2/c1-5-6(2,3)4;1-5(2,3)4/h5H2,1-4H3;4H2,1-3H3/q2*+1 |
| InChIKey | GPSSTCVQSWRDAF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze amino(trimethyl)azanium;ethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(trimethyl)azanium;ethyl(trimethyl)azanium?
The IUPAC name of amino(trimethyl)azanium;ethyl(trimethyl)azanium (CID 173458972) is amino(trimethyl)azanium;ethyl(trimethyl)azanium.
What is the SMILES notation for amino(trimethyl)azanium;ethyl(trimethyl)azanium?
The canonical SMILES for amino(trimethyl)azanium;ethyl(trimethyl)azanium is CC[N+](C)(C)C.C[N+](C)(C)N.
What is the InChIKey of amino(trimethyl)azanium;ethyl(trimethyl)azanium?
The InChIKey is GPSSTCVQSWRDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N.C3H11N2/c1-5-6(2,3)4;1-5(2,3)4/h5H2,1-4H3;4H2,1-3H3/q2*+1.
What are the key properties of amino(trimethyl)azanium;ethyl(trimethyl)azanium?
amino(trimethyl)azanium;ethyl(trimethyl)azanium has a molecular weight of 163.31 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for amino(trimethyl)azanium;ethyl(trimethyl)azanium is sourced from PubChem (CID 173458972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).