About dioxido(oxo)tin;lead(2+);hydrate
dioxido(oxo)tin;lead(2+);hydrate (PubChem CID 173459047) has the molecular formula H2O4PbSn
and a molecular weight of 391.92 g/mol. Its IUPAC name is dioxido(oxo)tin;lead(2+);hydrate.
Molecular Properties
| Compound Name | dioxido(oxo)tin;lead(2+);hydrate |
| PubChem CID | 173459047 |
| Molecular Formula | H2O4PbSn |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | dioxido(oxo)tin;lead(2+);hydrate |
| SMILES | O.O=[Sn]([O-])[O-].[Pb+2] |
| InChI | InChI=1S/H2O.3O.Pb.Sn/h1H2;;;;;/q;;2*-1;+2; |
| InChIKey | PKGVGBMFSMCHJG-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dioxido(oxo)tin;lead(2+);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)tin;lead(2+);hydrate?
The IUPAC name of dioxido(oxo)tin;lead(2+);hydrate (CID 173459047) is dioxido(oxo)tin;lead(2+);hydrate.
What is the SMILES notation for dioxido(oxo)tin;lead(2+);hydrate?
The canonical SMILES for dioxido(oxo)tin;lead(2+);hydrate is O.O=[Sn]([O-])[O-].[Pb+2].
What is the InChIKey of dioxido(oxo)tin;lead(2+);hydrate?
The InChIKey is PKGVGBMFSMCHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O.3O.Pb.Sn/h1H2;;;;;/q;;2*-1;+2;.
What are the key properties of dioxido(oxo)tin;lead(2+);hydrate?
dioxido(oxo)tin;lead(2+);hydrate has a molecular weight of 391.92 g/mol, XLogP of -4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)tin;lead(2+);hydrate is sourced from PubChem (CID 173459047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).