About dicesium;dioxido(oxo)tin
dicesium;dioxido(oxo)tin (PubChem CID 18408094) has the molecular formula Cs2O3Sn
and a molecular weight of 432.52 g/mol. Its IUPAC name is dicesium;dioxido(oxo)tin.
Molecular Properties
| Compound Name | dicesium;dioxido(oxo)tin |
| PubChem CID | 18408094 |
| Molecular Formula | Cs2O3Sn |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 433.70 |
| IUPAC Name | dicesium;dioxido(oxo)tin |
| SMILES | O=[Sn]([O-])[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/2Cs.3O.Sn/q2*+1;;2*-1; |
| InChIKey | IRMZFFJVAQCMQG-UHFFFAOYSA-N |
| XLogP | -8.87 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | -8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dicesium;dioxido(oxo)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicesium;dioxido(oxo)tin?
The IUPAC name of dicesium;dioxido(oxo)tin (CID 18408094) is dicesium;dioxido(oxo)tin.
What is the SMILES notation for dicesium;dioxido(oxo)tin?
The canonical SMILES for dicesium;dioxido(oxo)tin is O=[Sn]([O-])[O-].[Cs+].[Cs+].
What is the InChIKey of dicesium;dioxido(oxo)tin?
The InChIKey is IRMZFFJVAQCMQG-UHFFFAOYSA-N. The full InChI is InChI=1S/2Cs.3O.Sn/q2*+1;;2*-1;.
What are the key properties of dicesium;dioxido(oxo)tin?
dicesium;dioxido(oxo)tin has a molecular weight of 432.52 g/mol, XLogP of -8.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicesium;dioxido(oxo)tin is sourced from PubChem (CID 18408094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).