C12H13BrN2O3 — CID 173459152
1-[5-(2-aminoethenyl)-2,3-dimethyl-4-nitrophenyl]-2-bromoethanone (PubChem CID 173459152) has the molecular formula C12H13BrN2O3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-[5-(2-aminoethenyl)-2,3-dimethyl-4-nitrophenyl]-2-bromoethanone.
| Compound Name | 1-[5-(2-aminoethenyl)-2,3-dimethyl-4-nitrophenyl]-2-bromoethanone |
|---|---|
| PubChem CID | 173459152 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-[5-(2-aminoethenyl)-2,3-dimethyl-4-nitrophenyl]-2-bromoethanone |
| SMILES | Cc1c(C(=O)CBr)cc(C=CN)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H13BrN2O3/c1-7-8(2)12(15(17)18)9(3-4-14)5-10(7)11(16)6-13/h3-5H,6,14H2,1-2H3 |
| InChIKey | CISOQDQMMPWUAO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|