About sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride
sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride (PubChem CID 173459838) has the molecular formula C6H7NNaO5S+
and a molecular weight of 228.18 g/mol. Its IUPAC name is sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride.
Molecular Properties
| Compound Name | sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride |
| PubChem CID | 173459838 |
| Molecular Formula | C6H7NNaO5S+ |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride |
| SMILES | O=[N+](O)OS(=O)(=O)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C6H6NO5S.Na.H/c8-7(9)12-13(10,11)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;/q2*+1;-1 |
| InChIKey | NKSXJXYBTVQNIV-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride?
The IUPAC name of sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride (CID 173459838) is sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride.
What is the SMILES notation for sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride?
The canonical SMILES for sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride is O=[N+](O)OS(=O)(=O)c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride?
The InChIKey is NKSXJXYBTVQNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NO5S.Na.H/c8-7(9)12-13(10,11)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;/q2*+1;-1.
What are the key properties of sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride?
sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride has a molecular weight of 228.18 g/mol, XLogP of -2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonyloxy-hydroxy-oxoazanium;hydride is sourced from PubChem (CID 173459838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).