About CID 173459900
CID 173459900 (PubChem CID 173459900) has the molecular formula C8H15Sn
and a molecular weight of 229.92 g/mol.
Molecular Properties
| Compound Name | CID 173459900 |
| PubChem CID | 173459900 |
| Molecular Formula | C8H15Sn |
| Molecular Weight | 229.92 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | — |
| SMILES | CC1CCCCC1(C)[Sn] |
| InChI | InChI=1S/C8H15.Sn/c1-7-5-3-4-6-8(7)2;/h7H,3-6H2,1-2H3; |
| InChIKey | JAHAEVDTUGNLTE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173459900 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173459900?
The IUPAC name of CID 173459900 (CID 173459900) is not available.
What is the SMILES notation for CID 173459900?
The canonical SMILES for CID 173459900 is CC1CCCCC1(C)[Sn].
What is the InChIKey of CID 173459900?
The InChIKey is JAHAEVDTUGNLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.Sn/c1-7-5-3-4-6-8(7)2;/h7H,3-6H2,1-2H3;.
What are the key properties of CID 173459900?
CID 173459900 has a molecular weight of 229.92 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173459900 is sourced from PubChem (CID 173459900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).