About trichloro-(1,2-dimethylcyclohexyl)silane
trichloro-(1,2-dimethylcyclohexyl)silane (PubChem CID 18798602) has the molecular formula C8H15Cl3Si
and a molecular weight of 245.65 g/mol. Its IUPAC name is trichloro-(1,2-dimethylcyclohexyl)silane.
Molecular Properties
| Compound Name | trichloro-(1,2-dimethylcyclohexyl)silane |
| PubChem CID | 18798602 |
| Molecular Formula | C8H15Cl3Si |
| Molecular Weight | 245.65 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | trichloro-(1,2-dimethylcyclohexyl)silane |
| SMILES | CC1CCCCC1(C)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H15Cl3Si/c1-7-5-3-4-6-8(7,2)12(9,10)11/h7H,3-6H2,1-2H3 |
| InChIKey | RTAKXXBEFZTJPP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro-(1,2-dimethylcyclohexyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro-(1,2-dimethylcyclohexyl)silane?
The IUPAC name of trichloro-(1,2-dimethylcyclohexyl)silane (CID 18798602) is trichloro-(1,2-dimethylcyclohexyl)silane.
What is the SMILES notation for trichloro-(1,2-dimethylcyclohexyl)silane?
The canonical SMILES for trichloro-(1,2-dimethylcyclohexyl)silane is CC1CCCCC1(C)[Si](Cl)(Cl)Cl.
What is the InChIKey of trichloro-(1,2-dimethylcyclohexyl)silane?
The InChIKey is RTAKXXBEFZTJPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Cl3Si/c1-7-5-3-4-6-8(7,2)12(9,10)11/h7H,3-6H2,1-2H3.
What are the key properties of trichloro-(1,2-dimethylcyclohexyl)silane?
trichloro-(1,2-dimethylcyclohexyl)silane has a molecular weight of 245.65 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro-(1,2-dimethylcyclohexyl)silane is sourced from PubChem (CID 18798602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).