About sodium;3-butyl-2-phenylphenol;hydride
sodium;3-butyl-2-phenylphenol;hydride (PubChem CID 173461080) has the molecular formula C16H19NaO
and a molecular weight of 250.32 g/mol. Its IUPAC name is sodium;3-butyl-2-phenylphenol;hydride.
Molecular Properties
| Compound Name | sodium;3-butyl-2-phenylphenol;hydride |
| PubChem CID | 173461080 |
| Molecular Formula | C16H19NaO |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | sodium;3-butyl-2-phenylphenol;hydride |
| SMILES | CCCCc1cccc(O)c1-c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C16H18O.Na.H/c1-2-3-8-13-11-7-12-15(17)16(13)14-9-5-4-6-10-14;;/h4-7,9-12,17H,2-3,8H2,1H3;;/q;+1;-1 |
| InChIKey | BQLPGFJSKMADFD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;3-butyl-2-phenylphenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-butyl-2-phenylphenol;hydride?
The IUPAC name of sodium;3-butyl-2-phenylphenol;hydride (CID 173461080) is sodium;3-butyl-2-phenylphenol;hydride.
What is the SMILES notation for sodium;3-butyl-2-phenylphenol;hydride?
The canonical SMILES for sodium;3-butyl-2-phenylphenol;hydride is CCCCc1cccc(O)c1-c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;3-butyl-2-phenylphenol;hydride?
The InChIKey is BQLPGFJSKMADFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O.Na.H/c1-2-3-8-13-11-7-12-15(17)16(13)14-9-5-4-6-10-14;;/h4-7,9-12,17H,2-3,8H2,1H3;;/q;+1;-1.
What are the key properties of sodium;3-butyl-2-phenylphenol;hydride?
sodium;3-butyl-2-phenylphenol;hydride has a molecular weight of 250.32 g/mol, XLogP of 1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-butyl-2-phenylphenol;hydride is sourced from PubChem (CID 173461080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).