About 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid
1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid (PubChem CID 70021297) has the molecular formula C28H28O2
and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid |
| PubChem CID | 70021297 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCCc1cccc(C#Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H22.C4H6O2/c1-2-3-13-21-16-10-17-23(19-18-20-11-6-4-7-12-20)24(21)22-14-8-5-9-15-22;1-3(2)4(5)6/h4-12,14-17H,2-3,13H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | BCNSFHUGTVXDCQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid?
The IUPAC name of 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid (CID 70021297) is 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid.
What is the SMILES notation for 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid?
The canonical SMILES for 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCCCc1cccc(C#Cc2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid?
The InChIKey is BCNSFHUGTVXDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22.C4H6O2/c1-2-3-13-21-16-10-17-23(19-18-20-11-6-4-7-12-20)24(21)22-14-8-5-9-15-22;1-3(2)4(5)6/h4-12,14-17H,2-3,13H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid?
1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid has a molecular weight of 396.53 g/mol, XLogP of 6.74, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-phenyl-3-(2-phenylethynyl)benzene;2-methylprop-2-enoic acid is sourced from PubChem (CID 70021297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).