About 2-methylprop-2-enoic acid;2-nonylphenol
2-methylprop-2-enoic acid;2-nonylphenol (PubChem CID 66599734) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;2-nonylphenol.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;2-nonylphenol |
| PubChem CID | 66599734 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-methylprop-2-enoic acid;2-nonylphenol |
| SMILES | C=C(C)C(=O)O.CCCCCCCCCc1ccccc1O |
| InChI | InChI=1S/C15H24O.C4H6O2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-3(2)4(5)6/h9-10,12-13,16H,2-8,11H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | ZWBCPGAKJYVUHM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;2-nonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;2-nonylphenol?
The IUPAC name of 2-methylprop-2-enoic acid;2-nonylphenol (CID 66599734) is 2-methylprop-2-enoic acid;2-nonylphenol.
What is the SMILES notation for 2-methylprop-2-enoic acid;2-nonylphenol?
The canonical SMILES for 2-methylprop-2-enoic acid;2-nonylphenol is C=C(C)C(=O)O.CCCCCCCCCc1ccccc1O.
What is the InChIKey of 2-methylprop-2-enoic acid;2-nonylphenol?
The InChIKey is ZWBCPGAKJYVUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O.C4H6O2/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16;1-3(2)4(5)6/h9-10,12-13,16H,2-8,11H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;2-nonylphenol?
2-methylprop-2-enoic acid;2-nonylphenol has a molecular weight of 306.45 g/mol, XLogP of 5.33, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;2-nonylphenol is sourced from PubChem (CID 66599734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).