About cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane
cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane (PubChem CID 173462820) has the molecular formula C18H42Sn2
and a molecular weight of 495.96 g/mol. Its IUPAC name is cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane.
Molecular Properties
| Compound Name | cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane |
| PubChem CID | 173462820 |
| Molecular Formula | C18H42Sn2 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane |
| SMILES | CCCCCCCC[SnH](C)C.C[SnH](C)C1CCCCC1 |
| InChI | InChI=1S/C8H17.C6H11.4CH3.2Sn.2H/c1-3-5-7-8-6-4-2;1-2-4-6-5-3-1;;;;;;;;/h1,3-8H2,2H3;1H,2-6H2;4*1H3;;;; |
| InChIKey | OZWJQZNPZGBPFJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane?
The IUPAC name of cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane (CID 173462820) is cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane.
What is the SMILES notation for cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane?
The canonical SMILES for cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane is CCCCCCCC[SnH](C)C.C[SnH](C)C1CCCCC1.
What is the InChIKey of cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane?
The InChIKey is OZWJQZNPZGBPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.C6H11.4CH3.2Sn.2H/c1-3-5-7-8-6-4-2;1-2-4-6-5-3-1;;;;;;;;/h1,3-8H2,2H3;1H,2-6H2;4*1H3;;;;.
What are the key properties of cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane?
cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane has a molecular weight of 495.96 g/mol, XLogP of 6.64, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(dimethyl)stannane;dimethyl(octyl)stannane is sourced from PubChem (CID 173462820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).