About cadmium(2+);bis(oxido(dioxo)bismuth)
cadmium(2+);bis(oxido(dioxo)bismuth) (PubChem CID 173463460) has the molecular formula Bi2CdO6
and a molecular weight of 626.37 g/mol. Its IUPAC name is cadmium(2+);bis(oxido(dioxo)bismuth).
Molecular Properties
| Compound Name | cadmium(2+);bis(oxido(dioxo)bismuth) |
| PubChem CID | 173463460 |
| Molecular Formula | Bi2CdO6 |
| Molecular Weight | 626.37 g/mol |
| Exact Mass | 627.83 |
| IUPAC Name | cadmium(2+);bis(oxido(dioxo)bismuth) |
| SMILES | O=[Bi](=O)[O-].O=[Bi](=O)[O-].[Cd+2] |
| InChI | InChI=1S/2Bi.Cd.6O/q;;+2;;;;;2*-1 |
| InChIKey | GJOSRIBBCMQBDJ-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 626.37 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cadmium(2+);bis(oxido(dioxo)bismuth) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(oxido(dioxo)bismuth)?
The IUPAC name of cadmium(2+);bis(oxido(dioxo)bismuth) (CID 173463460) is cadmium(2+);bis(oxido(dioxo)bismuth).
What is the SMILES notation for cadmium(2+);bis(oxido(dioxo)bismuth)?
The canonical SMILES for cadmium(2+);bis(oxido(dioxo)bismuth) is O=[Bi](=O)[O-].O=[Bi](=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(oxido(dioxo)bismuth)?
The InChIKey is GJOSRIBBCMQBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2Bi.Cd.6O/q;;+2;;;;;2*-1.
What are the key properties of cadmium(2+);bis(oxido(dioxo)bismuth)?
cadmium(2+);bis(oxido(dioxo)bismuth) has a molecular weight of 626.37 g/mol, XLogP of -3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(oxido(dioxo)bismuth) is sourced from PubChem (CID 173463460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).