C19H29N4O3+ — CID 173464631
2-[4-(3-methyl-4-nitrophenyl)-4-aza-1-azoniabicyclo[3.2.2]nonan-1-yl]-N-propan-2-ylacetamide (PubChem CID 173464631) has the molecular formula C19H29N4O3+ and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[4-(3-methyl-4-nitrophenyl)-4-aza-1-azoniabicyclo[3.2.2]nonan-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-(3-methyl-4-nitrophenyl)-4-aza-1-azoniabicyclo[3.2.2]nonan-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 173464631 |
| Molecular Formula | C19H29N4O3+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2-[4-(3-methyl-4-nitrophenyl)-4-aza-1-azoniabicyclo[3.2.2]nonan-1-yl]-N-propan-2-ylacetamide |
| SMILES | Cc1cc(N2CC[N+]3(CC(=O)NC(C)C)CCC2CC3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N4O3/c1-14(2)20-19(24)13-23-9-6-16(7-10-23)21(8-11-23)17-4-5-18(22(25)26)15(3)12-17/h4-5,12,14,16H,6-11,13H2,1-3H3/p+1 |
| InChIKey | JCQRMMIANZEHTP-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|