C24H26N4O6S — CID 173465025
(2S)-2-[[(2S)-2-[5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]propanoyl]amino]propanamide (PubChem CID 173465025) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]propanoyl]amino]propanamide.
| Compound Name | (2S)-2-[[(2S)-2-[5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]propanoyl]amino]propanamide |
|---|---|
| PubChem CID | 173465025 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]propanoyl]amino]propanamide |
| SMILES | COc1cc(C=C2S/C(=N\c3ccccc3)N([C@@H](C)C(=O)N[C@@H](C)C(N)=O)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C24H26N4O6S/c1-13(21(25)30)26-22(31)14(2)28-23(32)19(35-24(28)27-16-8-6-5-7-9-16)12-15-10-17(33-3)20(29)18(11-15)34-4/h5-14,29H,1-4H3,(H2,25,30)(H,26,31)/b19-12?,27-24-/t13-,14-/m0/s1 |
| InChIKey | CGFQYESCYRYMQK-BDYRQPTHSA-N |
| XLogP | 2.39 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|