C18H17FN8O — CID 173466535
N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyrimidine-4-carboximidoyl]formamide (PubChem CID 173466535) has the molecular formula C18H17FN8O and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyrimidine-4-carboximidoyl]formamide.
| Compound Name | N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyrimidine-4-carboximidoyl]formamide |
|---|---|
| PubChem CID | 173466535 |
| Molecular Formula | C18H17FN8O |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyrimidine-4-carboximidoyl]formamide |
| SMILES | [H]/N=C(\NC=O)c1cc(Nc2cnccn2)nc(N[C@@H](C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H17FN8O/c1-11(12-2-4-13(19)5-3-12)24-18-25-14(17(20)23-10-28)8-15(27-18)26-16-9-21-6-7-22-16/h2-11H,1H3,(H2,20,23,28)(H2,22,24,25,26,27)/t11-/m0/s1 |
| InChIKey | YIMVQZMVNDZSSC-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|