C19H18FN7O — CID 173466536
N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyridine-4-carboximidoyl]formamide (PubChem CID 173466536) has the molecular formula C19H18FN7O and a molecular weight of 379.40 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyridine-4-carboximidoyl]formamide.
| Compound Name | N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyridine-4-carboximidoyl]formamide |
|---|---|
| PubChem CID | 173466536 |
| Molecular Formula | C19H18FN7O |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-6-(pyrazin-2-ylamino)pyridine-4-carboximidoyl]formamide |
| SMILES | [H]/N=C(\NC=O)c1cc(Nc2cnccn2)nc(N[C@@H](C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H18FN7O/c1-12(13-2-4-15(20)5-3-13)25-16-8-14(19(21)24-11-28)9-17(26-16)27-18-10-22-6-7-23-18/h2-12H,1H3,(H2,21,24,28)(H2,23,25,26,27)/t12-/m0/s1 |
| InChIKey | LLXZPALUTBWUOR-LBPRGKRZSA-N |
| XLogP | 3.00 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|