C26H24AsCl2N4O3S — CID 173470274
CID 173470274 (PubChem CID 173470274) has the molecular formula C26H24AsCl2N4O3S and a molecular weight of 618.40 g/mol.
| Compound Name | CID 173470274 |
|---|---|
| PubChem CID | 173470274 |
| Molecular Formula | C26H24AsCl2N4O3S |
| Molecular Weight | 618.40 g/mol |
| Exact Mass | 617.02 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)c1cnc2ccc(-c3cc(Cl)c(O)c(Cl)c3)cc2c1[As]c1ccc(N2CCCC(N)C2)nc1 |
| InChI | InChI=1S/C26H24AsCl2N4O3S/c1-37(35,36)23-13-31-22-6-4-15(16-10-20(28)26(34)21(29)11-16)9-19(22)25(23)27-17-5-7-24(32-12-17)33-8-2-3-18(30)14-33/h4-7,9-13,18,34H,2-3,8,14,30H2,1H3 |
| InChIKey | DZVKPHBSDRDYLO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|