C21H34 — CID 173470691
4-(5-pent-4-enylundeca-4,10-dienyl)cyclopentene (PubChem CID 173470691) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 4-(5-pent-4-enylundeca-4,10-dienyl)cyclopentene.
| Compound Name | 4-(5-pent-4-enylundeca-4,10-dienyl)cyclopentene |
|---|---|
| PubChem CID | 173470691 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 4-(5-pent-4-enylundeca-4,10-dienyl)cyclopentene |
| SMILES | C=CCCCCC(=CCCCC1CC=CC1)CCCC=C |
| InChI | InChI=1S/C21H34/c1-3-5-7-9-15-20(14-8-6-4-2)16-10-11-17-21-18-12-13-19-21/h3-4,12-13,16,21H,1-2,5-11,14-15,17-19H2 |
| InChIKey | JFJARUIPENTFAT-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|