C21H36 — CID 56610542
7-but-3-enylheptadeca-1,7,16-triene (PubChem CID 56610542) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 7-but-3-enylheptadeca-1,7,16-triene.
| Compound Name | 7-but-3-enylheptadeca-1,7,16-triene |
|---|---|
| PubChem CID | 56610542 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 7-but-3-enylheptadeca-1,7,16-triene |
| SMILES | C=CCCCCCCCC=C(CCC=C)CCCCC=C |
| InChI | InChI=1S/C21H36/c1-4-7-10-12-13-14-15-17-20-21(18-9-6-3)19-16-11-8-5-2/h4-6,20H,1-3,7-19H2 |
| InChIKey | IRAOJBOZEFECGQ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|