C22H24ClN7O2 — CID 173472347
1-[1-amino-3-imino-1-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]prop-1-en-2-yl]-3-(4-chlorophenyl)urea (PubChem CID 173472347) has the molecular formula C22H24ClN7O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 1-[1-amino-3-imino-1-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]prop-1-en-2-yl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[1-amino-3-imino-1-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]prop-1-en-2-yl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 173472347 |
| Molecular Formula | C22H24ClN7O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-[1-amino-3-imino-1-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]prop-1-en-2-yl]-3-(4-chlorophenyl)urea |
| SMILES | [H]/N=C/C(NC(=O)Nc1ccc(Cl)cc1)=C(N)c1nc2ccc(CN3CCOCC3)cc2[nH]1 |
| InChI | InChI=1S/C22H24ClN7O2/c23-15-2-4-16(5-3-15)26-22(31)29-19(12-24)20(25)21-27-17-6-1-14(11-18(17)28-21)13-30-7-9-32-10-8-30/h1-6,11-12,24H,7-10,13,25H2,(H,27,28)(H2,26,29,31)/b20-19?,24-12+ |
| InChIKey | GYTIALTYCJZQPT-AJTZCLNQSA-N |
| XLogP | 3.15 |
| TPSA | 132.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|