About (1-hydroxy-2-oxopropyl) decanoate
(1-hydroxy-2-oxopropyl) decanoate (PubChem CID 173472783) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is (1-hydroxy-2-oxopropyl) decanoate.
Molecular Properties
| Compound Name | (1-hydroxy-2-oxopropyl) decanoate |
| PubChem CID | 173472783 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (1-hydroxy-2-oxopropyl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC(O)C(C)=O |
| InChI | InChI=1S/C13H24O4/c1-3-4-5-6-7-8-9-10-12(15)17-13(16)11(2)14/h13,16H,3-10H2,1-2H3 |
| InChIKey | AJVLGEWSOQBQSL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2-oxopropyl) decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2-oxopropyl) decanoate?
The IUPAC name of (1-hydroxy-2-oxopropyl) decanoate (CID 173472783) is (1-hydroxy-2-oxopropyl) decanoate.
What is the SMILES notation for (1-hydroxy-2-oxopropyl) decanoate?
The canonical SMILES for (1-hydroxy-2-oxopropyl) decanoate is CCCCCCCCCC(=O)OC(O)C(C)=O.
What is the InChIKey of (1-hydroxy-2-oxopropyl) decanoate?
The InChIKey is AJVLGEWSOQBQSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-3-4-5-6-7-8-9-10-12(15)17-13(16)11(2)14/h13,16H,3-10H2,1-2H3.
What are the key properties of (1-hydroxy-2-oxopropyl) decanoate?
(1-hydroxy-2-oxopropyl) decanoate has a molecular weight of 244.33 g/mol, XLogP of 2.58, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2-oxopropyl) decanoate is sourced from PubChem (CID 173472783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).