C20H13ClFN3O2 — CID 173475587
1-(4-chloro-2-methoxyphenyl)-4-fluoro-N-prop-2-ynimidoylisoquinoline-7-carboxamide (PubChem CID 173475587) has the molecular formula C20H13ClFN3O2 and a molecular weight of 381.79 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxyphenyl)-4-fluoro-N-prop-2-ynimidoylisoquinoline-7-carboxamide.
| Compound Name | 1-(4-chloro-2-methoxyphenyl)-4-fluoro-N-prop-2-ynimidoylisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 173475587 |
| Molecular Formula | C20H13ClFN3O2 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-(4-chloro-2-methoxyphenyl)-4-fluoro-N-prop-2-ynimidoylisoquinoline-7-carboxamide |
| SMILES | [H]/N=C(\C#C)NC(=O)c1ccc2c(F)cnc(-c3ccc(Cl)cc3OC)c2c1 |
| InChI | InChI=1S/C20H13ClFN3O2/c1-3-18(23)25-20(26)11-4-6-13-15(8-11)19(24-10-16(13)22)14-7-5-12(21)9-17(14)27-2/h1,4-10H,2H3,(H2,23,25,26) |
| InChIKey | JFPUMBRCHPSKRM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|