C21H15N3O2S — CID 173478629
4-amino-2-[(3-hydroxy-1-benzothiophen-2-yl)methylidene]-3-methylpyrido[1,2-a]benzimidazol-1-one (PubChem CID 173478629) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-amino-2-[(3-hydroxy-1-benzothiophen-2-yl)methylidene]-3-methylpyrido[1,2-a]benzimidazol-1-one.
| Compound Name | 4-amino-2-[(3-hydroxy-1-benzothiophen-2-yl)methylidene]-3-methylpyrido[1,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 173478629 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 4-amino-2-[(3-hydroxy-1-benzothiophen-2-yl)methylidene]-3-methylpyrido[1,2-a]benzimidazol-1-one |
| SMILES | Cc1c(N)c2nc3ccccc3n2c(=O)c1=Cc1sc2ccccc2c1O |
| InChI | InChI=1S/C21H15N3O2S/c1-11-13(10-17-19(25)12-6-2-5-9-16(12)27-17)21(26)24-15-8-4-3-7-14(15)23-20(24)18(11)22/h2-10,25H,22H2,1H3 |
| InChIKey | LFMQIDOPUBRQNY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|