C25H33N5O2 — CID 173479637
2-ethenyl-1-[4-methyl-3-[(3R)-1-propylpyrrolidin-3-yl]oxycyclohexa-2,4-dien-1-ylidene]-3-[3-(1-nitrosoethyl)phenyl]guanidine (PubChem CID 173479637) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-ethenyl-1-[4-methyl-3-[(3R)-1-propylpyrrolidin-3-yl]oxycyclohexa-2,4-dien-1-ylidene]-3-[3-(1-nitrosoethyl)phenyl]guanidine.
| Compound Name | 2-ethenyl-1-[4-methyl-3-[(3R)-1-propylpyrrolidin-3-yl]oxycyclohexa-2,4-dien-1-ylidene]-3-[3-(1-nitrosoethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 173479637 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 2-ethenyl-1-[4-methyl-3-[(3R)-1-propylpyrrolidin-3-yl]oxycyclohexa-2,4-dien-1-ylidene]-3-[3-(1-nitrosoethyl)phenyl]guanidine |
| SMILES | C=C/N=C(\N=C1C=C(O[C@@H]2CCN(CCC)C2)C(C)=CC1)Nc1cccc(C(C)N=O)c1 |
| InChI | InChI=1S/C25H33N5O2/c1-5-13-30-14-12-23(17-30)32-24-16-22(11-10-18(24)3)28-25(26-6-2)27-21-9-7-8-20(15-21)19(4)29-31/h6-10,15-16,19,23H,2,5,11-14,17H2,1,3-4H3,(H,26,27)/t19?,23-/m1/s1 |
| InChIKey | GGYIAWOTBCXVFR-LEQGEALCSA-N |
| XLogP | 5.60 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|