C12H7F3O4 — CID 173480467
4-hydroxy-5-[2-(trifluoromethyl)phenyl]cyclopentane-1,2,3-trione (PubChem CID 173480467) has the molecular formula C12H7F3O4 and a molecular weight of 272.18 g/mol. Its IUPAC name is 4-hydroxy-5-[2-(trifluoromethyl)phenyl]cyclopentane-1,2,3-trione.
| Compound Name | 4-hydroxy-5-[2-(trifluoromethyl)phenyl]cyclopentane-1,2,3-trione |
|---|---|
| PubChem CID | 173480467 |
| Molecular Formula | C12H7F3O4 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 4-hydroxy-5-[2-(trifluoromethyl)phenyl]cyclopentane-1,2,3-trione |
| SMILES | O=C1C(=O)C(O)C(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H7F3O4/c13-12(14,15)6-4-2-1-3-5(6)7-8(16)10(18)11(19)9(7)17/h1-4,7-8,16H |
| InChIKey | ZOSURMUGVFQBTL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|