C28H26NO7Rb — CID 173480809
(1S,4aR,11R,11aR,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7-tetrahydroxy-11-phenyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;rubidium(1+) (PubChem CID 173480809) has the molecular formula C28H26NO7Rb and a molecular weight of 573.98 g/mol. Its IUPAC name is (1S,4aR,11R,11aR,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7-tetrahydroxy-11-phenyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;rubidium(1+).
| Compound Name | (1S,4aR,11R,11aR,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7-tetrahydroxy-11-phenyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;rubidium(1+) |
|---|---|
| PubChem CID | 173480809 |
| Molecular Formula | C28H26NO7Rb |
| Molecular Weight | 573.98 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | (1S,4aR,11R,11aR,12aS)-3-acetyl-1-(dimethylamino)-4,4a,6,7-tetrahydroxy-11-phenyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;rubidium(1+) |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@H](c4cc[c-]cc4)[C@H]3C[C@H]2[C@H](N(C)C)C1=O.[Rb+] |
| InChI | InChI=1S/C28H26NO7.Rb/c1-13(30)19-25(33)23(29(2)3)17-12-16-20(14-8-5-4-6-9-14)15-10-7-11-18(31)21(15)24(32)22(16)27(35)28(17,36)26(19)34;/h5-11,16-17,20,23,31-32,34,36H,12H2,1-3H3;/q-1;+1/t16-,17+,20-,23+,28-;/m1./s1 |
| InChIKey | XEHQXUVKPLCEBD-LXUYAFDVSA-N |
| XLogP | -0.54 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.98 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|