C27H24F2N2O7 — CID 54740241
(4S,4aS,5aR,6S,12aR)-6-(3,5-difluorophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54740241) has the molecular formula C27H24F2N2O7 and a molecular weight of 526.49 g/mol. Its IUPAC name is (4S,4aS,5aR,6S,12aR)-6-(3,5-difluorophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,6S,12aR)-6-(3,5-difluorophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54740241 |
| Molecular Formula | C27H24F2N2O7 |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | (4S,4aS,5aR,6S,12aR)-6-(3,5-difluorophenyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@H](c4cc(F)cc(F)c4)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C27H24F2N2O7/c1-31(2)21-15-9-14-17(10-6-11(28)8-12(29)7-10)13-4-3-5-16(32)18(13)22(33)19(14)24(35)27(15,38)25(36)20(23(21)34)26(30)37/h3-8,14-15,17,21,32-33,36,38H,9H2,1-2H3,(H2,30,37)/t14-,15+,17+,21+,27+/m1/s1 |
| InChIKey | NWBFBTHXBYXTPI-CYXIMNPOSA-N |
| XLogP | 1.83 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|