C55H42Si — CID 173480984
14-(9,9-dimethylfluoren-2-yl)-21-(3,5-diphenylphenyl)-10,10-dimethyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene (PubChem CID 173480984) has the molecular formula C55H42Si and a molecular weight of 731.03 g/mol. Its IUPAC name is 14-(9,9-dimethylfluoren-2-yl)-21-(3,5-diphenylphenyl)-10,10-dimethyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene.
| Compound Name | 14-(9,9-dimethylfluoren-2-yl)-21-(3,5-diphenylphenyl)-10,10-dimethyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 173480984 |
| Molecular Formula | C55H42Si |
| Molecular Weight | 731.03 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | 14-(9,9-dimethylfluoren-2-yl)-21-(3,5-diphenylphenyl)-10,10-dimethyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c4cc5c(cc34)[Si](C)(C)c3ccccc3-5)cc21 |
| InChI | InChI=1S/C55H42Si/c1-55(2)49-25-15-13-21-41(49)42-28-27-37(32-50(42)55)53-44-23-11-12-24-45(44)54(47-33-46-43-22-14-16-26-51(43)56(3,4)52(46)34-48(47)53)40-30-38(35-17-7-5-8-18-35)29-39(31-40)36-19-9-6-10-20-36/h5-34H,1-4H3 |
| InChIKey | CLLAOQITSXBNOK-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.03 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|