C52H42Si — CID 173480612
8,13-bis(9,9-dimethylfluoren-2-yl)-5,5-dimethylanthra[2,1-b][1]benzosilole (PubChem CID 173480612) has the molecular formula C52H42Si and a molecular weight of 694.99 g/mol. Its IUPAC name is 8,13-bis(9,9-dimethylfluoren-2-yl)-5,5-dimethylanthra[2,1-b][1]benzosilole.
| Compound Name | 8,13-bis(9,9-dimethylfluoren-2-yl)-5,5-dimethylanthra[2,1-b][1]benzosilole |
|---|---|
| PubChem CID | 173480612 |
| Molecular Formula | C52H42Si |
| Molecular Weight | 694.99 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 8,13-bis(9,9-dimethylfluoren-2-yl)-5,5-dimethylanthra[2,1-b][1]benzosilole |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c4ccccc4c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4c5c(ccc34)[Si](C)(C)c3ccccc3-5)cc21 |
| InChI | InChI=1S/C52H42Si/c1-51(2)41-20-12-9-15-33(41)35-25-23-31(29-43(35)51)47-37-17-7-8-18-38(37)48(32-24-26-36-34-16-10-13-21-42(34)52(3,4)44(36)30-32)50-40(47)27-28-46-49(50)39-19-11-14-22-45(39)53(46,5)6/h7-30H,1-6H3 |
| InChIKey | LVFLEOQDQBLYGM-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.99 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|