C21H25N5O2 — CID 173481126
1-(1-amino-3-oxo-1-phenylbut-1-en-2-yl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea (PubChem CID 173481126) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(1-amino-3-oxo-1-phenylbut-1-en-2-yl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea.
| Compound Name | 1-(1-amino-3-oxo-1-phenylbut-1-en-2-yl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 173481126 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-(1-amino-3-oxo-1-phenylbut-1-en-2-yl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
| SMILES | CC(=O)C(NC(=O)NCCc1ccc2c(n1)NCCC2)=C(N)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O2/c1-14(27)19(18(22)15-6-3-2-4-7-15)26-21(28)24-13-11-17-10-9-16-8-5-12-23-20(16)25-17/h2-4,6-7,9-10H,5,8,11-13,22H2,1H3,(H,23,25)(H2,24,26,28) |
| InChIKey | AZWQBOAXQBZXFD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|