C17H17F3N4O — CID 70887077
1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 70887077) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 70887077 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(NCCc1ccc2c(n1)NCCC2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H17F3N4O/c18-12-5-6-13(15(20)14(12)19)24-17(25)22-9-7-11-4-3-10-2-1-8-21-16(10)23-11/h3-6H,1-2,7-9H2,(H,21,23)(H2,22,24,25) |
| InChIKey | WZWTYIMWUSJKBI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|