C19H22Cl2N4O — CID 71590501
1-[(3,4-dichlorophenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)ethyl]urea (PubChem CID 71590501) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)ethyl]urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 71590501 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccc2c(n1)NCCCC2)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N4O/c20-16-7-4-13(11-17(16)21)12-24-19(26)23-10-8-15-6-5-14-3-1-2-9-22-18(14)25-15/h4-7,11H,1-3,8-10,12H2,(H,22,25)(H2,23,24,26) |
| InChIKey | DUJFEXCOKXQRQK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |