C16H17Cl2N4O+ — CID 90728318
[6-[2-[(3,4-dichlorophenyl)methylcarbamoylamino]ethyl]-2-pyridinyl]-methylideneazanium (PubChem CID 90728318) has the molecular formula C16H17Cl2N4O+ and a molecular weight of 352.25 g/mol. Its IUPAC name is [6-[2-[(3,4-dichlorophenyl)methylcarbamoylamino]ethyl]-2-pyridinyl]-methylideneazanium.
| Compound Name | [6-[2-[(3,4-dichlorophenyl)methylcarbamoylamino]ethyl]-2-pyridinyl]-methylideneazanium |
|---|---|
| PubChem CID | 90728318 |
| Molecular Formula | C16H17Cl2N4O+ |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | [6-[2-[(3,4-dichlorophenyl)methylcarbamoylamino]ethyl]-2-pyridinyl]-methylideneazanium |
| SMILES | C=[NH+]c1cccc(CCNC(=O)NCc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H16Cl2N4O/c1-19-15-4-2-3-12(22-15)7-8-20-16(23)21-10-11-5-6-13(17)14(18)9-11/h2-6,9H,1,7-8,10H2,(H2,20,21,23)/p+1 |
| InChIKey | DICRNDJFHLBDTG-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|