C21H27N5O2 — CID 46207633
1-(4-morpholin-4-ylphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea (PubChem CID 46207633) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea.
| Compound Name | 1-(4-morpholin-4-ylphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 46207633 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-(4-morpholin-4-ylphenyl)-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1ccc2c(n1)NCCC2)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27N5O2/c27-21(23-11-9-18-4-3-16-2-1-10-22-20(16)24-18)25-17-5-7-19(8-6-17)26-12-14-28-15-13-26/h3-8H,1-2,9-15H2,(H,22,24)(H2,23,25,27) |
| InChIKey | KHWYGHLYOJZCMZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|