C22H31N5O2 — CID 143997787
N-methyl-4-morpholin-4-ylaniline;N-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]formamide (PubChem CID 143997787) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-methyl-4-morpholin-4-ylaniline;N-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]formamide.
| Compound Name | N-methyl-4-morpholin-4-ylaniline;N-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]formamide |
|---|---|
| PubChem CID | 143997787 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-methyl-4-morpholin-4-ylaniline;N-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]formamide |
| SMILES | CNc1ccc(N2CCOCC2)cc1.O=CNCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C11H15N3O.C11H16N2O/c15-8-12-7-5-10-4-3-9-2-1-6-13-11(9)14-10;1-12-10-2-4-11(5-3-10)13-6-8-14-9-7-13/h3-4,8H,1-2,5-7H2,(H,12,15)(H,13,14);2-5,12H,6-9H2,1H3 |
| InChIKey | GRZFUQHAIRILNS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|