C29H39FN4O3 — CID 140877958
(2R)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-2-methyl-3-(3-morpholin-4-ylphenyl)butanoic acid (PubChem CID 140877958) has the molecular formula C29H39FN4O3 and a molecular weight of 510.65 g/mol. Its IUPAC name is (2R)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-2-methyl-3-(3-morpholin-4-ylphenyl)butanoic acid.
| Compound Name | (2R)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-2-methyl-3-(3-morpholin-4-ylphenyl)butanoic acid |
|---|---|
| PubChem CID | 140877958 |
| Molecular Formula | C29H39FN4O3 |
| Molecular Weight | 510.65 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | (2R)-4-[(3R)-3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-2-methyl-3-(3-morpholin-4-ylphenyl)butanoic acid |
| SMILES | C[C@@H](C(=O)O)C(CN1CC[C@](F)(CCc2ccc3c(n2)NCCC3)C1)c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C29H39FN4O3/c1-21(28(35)36)26(23-4-2-6-25(18-23)34-14-16-37-17-15-34)19-33-13-11-29(30,20-33)10-9-24-8-7-22-5-3-12-31-27(22)32-24/h2,4,6-8,18,21,26H,3,5,9-17,19-20H2,1H3,(H,31,32)(H,35,36)/t21-,26?,29-/m1/s1 |
| InChIKey | DFLRZSKIKQGUMS-CSVXWWCFSA-N |
| XLogP | 4.13 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |