C26H33FIN3O4 — CID 147823168
4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-iodooxyethoxy)phenyl]butanoic acid (PubChem CID 147823168) has the molecular formula C26H33FIN3O4 and a molecular weight of 597.47 g/mol. Its IUPAC name is 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-iodooxyethoxy)phenyl]butanoic acid.
| Compound Name | 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-iodooxyethoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 147823168 |
| Molecular Formula | C26H33FIN3O4 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | 4-[3-fluoro-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]-3-[3-(2-iodooxyethoxy)phenyl]butanoic acid |
| SMILES | O=C(O)CC(CN1CCC(F)(CCc2ccc3c(n2)NCCC3)C1)c1cccc(OCCOI)c1 |
| InChI | InChI=1S/C26H33FIN3O4/c27-26(9-8-22-7-6-19-4-2-11-29-25(19)30-22)10-12-31(18-26)17-21(16-24(32)33)20-3-1-5-23(15-20)34-13-14-35-28/h1,3,5-7,15,21H,2,4,8-14,16-18H2,(H,29,30)(H,32,33) |
| InChIKey | HPQCTLKMURKTCA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|