C8H17NOS — CID 173481918
(2S,5R)-2-amino-3-methyl-5-methylsulfanylhexanal (PubChem CID 173481918) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is (2S,5R)-2-amino-3-methyl-5-methylsulfanylhexanal.
| Compound Name | (2S,5R)-2-amino-3-methyl-5-methylsulfanylhexanal |
|---|---|
| PubChem CID | 173481918 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (2S,5R)-2-amino-3-methyl-5-methylsulfanylhexanal |
| SMILES | CS[C@H](C)CC(C)[C@H](N)C=O |
| InChI | InChI=1S/C8H17NOS/c1-6(8(9)5-10)4-7(2)11-3/h5-8H,4,9H2,1-3H3/t6?,7-,8-/m1/s1 |
| InChIKey | CFTIFJZDXQJONG-SPDVFEMOSA-N |
| XLogP | 1.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|