C11H21NO9 — CID 21126222
(2R,3R,4S,5R,7R,8R,9R,10R)-2-amino-3,4,5,7,8,9,10-heptahydroxyundecanedial (PubChem CID 21126222) has the molecular formula C11H21NO9 and a molecular weight of 311.29 g/mol. Its IUPAC name is (2R,3R,4S,5R,7R,8R,9R,10R)-2-amino-3,4,5,7,8,9,10-heptahydroxyundecanedial.
| Compound Name | (2R,3R,4S,5R,7R,8R,9R,10R)-2-amino-3,4,5,7,8,9,10-heptahydroxyundecanedial |
|---|---|
| PubChem CID | 21126222 |
| Molecular Formula | C11H21NO9 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R,3R,4S,5R,7R,8R,9R,10R)-2-amino-3,4,5,7,8,9,10-heptahydroxyundecanedial |
| SMILES | N[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C11H21NO9/c12-4(2-13)8(18)9(19)5(15)1-6(16)10(20)11(21)7(17)3-14/h2-11,15-21H,1,12H2/t4-,5+,6+,7-,8+,9-,10+,11-/m0/s1 |
| InChIKey | WYCVCBXIFGHWMA-YLGJMLSFSA-N |
| XLogP | -5.37 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|