C20H14ClF3N4O — CID 173483429
3-[C-(2-aminoethenyl)-N-(4-chlorophenyl)carbonimidoyl]-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one (PubChem CID 173483429) has the molecular formula C20H14ClF3N4O and a molecular weight of 418.81 g/mol. Its IUPAC name is 3-[C-(2-aminoethenyl)-N-(4-chlorophenyl)carbonimidoyl]-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one.
| Compound Name | 3-[C-(2-aminoethenyl)-N-(4-chlorophenyl)carbonimidoyl]-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
|---|---|
| PubChem CID | 173483429 |
| Molecular Formula | C20H14ClF3N4O |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[C-(2-aminoethenyl)-N-(4-chlorophenyl)carbonimidoyl]-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one |
| SMILES | NC=C/C(=N\c1ccc(Cl)cc1)c1nn(-c2cccc(C(F)(F)F)c2)ccc1=O |
| InChI | InChI=1S/C20H14ClF3N4O/c21-14-4-6-15(7-5-14)26-17(8-10-25)19-18(29)9-11-28(27-19)16-3-1-2-13(12-16)20(22,23)24/h1-12H,25H2/b10-8?,26-17+ |
| InChIKey | XFQFPAOACGFAQV-DIGCQMGVSA-N |
| XLogP | 4.50 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|