C23H20N6O — CID 147813355
3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-(4-imidazol-1-yl-2-methylphenyl)pyridazin-4-one (PubChem CID 147813355) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-(4-imidazol-1-yl-2-methylphenyl)pyridazin-4-one.
| Compound Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-(4-imidazol-1-yl-2-methylphenyl)pyridazin-4-one |
|---|---|
| PubChem CID | 147813355 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-(4-imidazol-1-yl-2-methylphenyl)pyridazin-4-one |
| SMILES | Cc1cc(-n2ccnc2)ccc1-n1ccc(=O)c(/C(C=CN)=N/c2ccccc2)n1 |
| InChI | InChI=1S/C23H20N6O/c1-17-15-19(28-14-12-25-16-28)7-8-21(17)29-13-10-22(30)23(27-29)20(9-11-24)26-18-5-3-2-4-6-18/h2-16H,24H2,1H3/b11-9?,26-20+ |
| InChIKey | KYOLUZQZYGYOIC-MRPIEPFISA-N |
| XLogP | 3.32 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|