C21H18F2N4O2 — CID 148837910
3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[2-(difluoromethoxy)phenyl]-5-methylpyridazin-4-one (PubChem CID 148837910) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[2-(difluoromethoxy)phenyl]-5-methylpyridazin-4-one.
| Compound Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[2-(difluoromethoxy)phenyl]-5-methylpyridazin-4-one |
|---|---|
| PubChem CID | 148837910 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[2-(difluoromethoxy)phenyl]-5-methylpyridazin-4-one |
| SMILES | Cc1cn(-c2ccccc2OC(F)F)nc(/C(C=CN)=N/c2ccccc2)c1=O |
| InChI | InChI=1S/C21H18F2N4O2/c1-14-13-27(17-9-5-6-10-18(17)29-21(22)23)26-19(20(14)28)16(11-12-24)25-15-7-3-2-4-8-15/h2-13,21H,24H2,1H3/b12-11?,25-16+ |
| InChIKey | AZWXHSIVAYGVDN-BTGUXDPXSA-N |
| XLogP | 3.74 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|