C14H13F2N3O4 — CID 58072502
1-[2-(difluoromethoxy)phenyl]-N-methoxy-5-methyl-4-oxopyridazine-3-carboxamide (PubChem CID 58072502) has the molecular formula C14H13F2N3O4 and a molecular weight of 325.27 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-N-methoxy-5-methyl-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-N-methoxy-5-methyl-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 58072502 |
| Molecular Formula | C14H13F2N3O4 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-N-methoxy-5-methyl-4-oxopyridazine-3-carboxamide |
| SMILES | CONC(=O)c1nn(-c2ccccc2OC(F)F)cc(C)c1=O |
| InChI | InChI=1S/C14H13F2N3O4/c1-8-7-19(17-11(12(8)20)13(21)18-22-2)9-5-3-4-6-10(9)23-14(15)16/h3-7,14H,1-2H3,(H,18,21) |
| InChIKey | NMBNUHBUGSQBNT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|