C16H17F2N3O3 — CID 159209906
1-[2-(difluoromethoxy)phenyl]-3-[3-(methylamino)prop-2-enoyl]pyridazin-4-one;methane (PubChem CID 159209906) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-[3-(methylamino)prop-2-enoyl]pyridazin-4-one;methane.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-[3-(methylamino)prop-2-enoyl]pyridazin-4-one;methane |
|---|---|
| PubChem CID | 159209906 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-[3-(methylamino)prop-2-enoyl]pyridazin-4-one;methane |
| SMILES | C.CNC=CC(=O)c1nn(-c2ccccc2OC(F)F)ccc1=O |
| InChI | InChI=1S/C15H13F2N3O3.CH4/c1-18-8-6-11(21)14-12(22)7-9-20(19-14)10-4-2-3-5-13(10)23-15(16)17;/h2-9,15,18H,1H3;1H4 |
| InChIKey | KQJCPFYSICQTNN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|