C24H23F2N5O — CID 149260844
3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]pyridazin-4-one (PubChem CID 149260844) has the molecular formula C24H23F2N5O and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]pyridazin-4-one.
| Compound Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]pyridazin-4-one |
|---|---|
| PubChem CID | 149260844 |
| Molecular Formula | C24H23F2N5O |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 3-[C-(2-aminoethenyl)-N-phenylcarbonimidoyl]-1-[4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]pyridazin-4-one |
| SMILES | Cc1cc(N2CCC(F)(F)C2)ccc1-n1ccc(=O)c(/C(C=CN)=N/c2ccccc2)n1 |
| InChI | InChI=1S/C24H23F2N5O/c1-17-15-19(30-14-11-24(25,26)16-30)7-8-21(17)31-13-10-22(32)23(29-31)20(9-12-27)28-18-5-3-2-4-6-18/h2-10,12-13,15H,11,14,16,27H2,1H3/b12-9?,28-20+ |
| InChIKey | KRRPXPKEAGAKQA-NFNIVKQTSA-N |
| XLogP | 3.98 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|