C31H30BFN4O3 — CID 173484646
CID 173484646 (PubChem CID 173484646) has the molecular formula C31H30BFN4O3 and a molecular weight of 536.42 g/mol.
| Compound Name | CID 173484646 |
|---|---|
| PubChem CID | 173484646 |
| Molecular Formula | C31H30BFN4O3 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\NC([B])=O)c1ccccc1-c1ccc(Cc2c(CCC)nc(C)n(-c3ccc(OCCF)cc3)c2=O)cc1 |
| InChI | InChI=1S/C31H30BFN4O3/c1-3-6-28-27(30(38)37(20(2)35-28)23-13-15-24(16-14-23)40-18-17-33)19-21-9-11-22(12-10-21)25-7-4-5-8-26(25)29(34)36-31(32)39/h4-5,7-16H,3,6,17-19H2,1-2H3,(H2,34,36,39) |
| InChIKey | DAMITSDNUSLAKS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|