C35H37BN4O3 — CID 173484664
CID 173484664 (PubChem CID 173484664) has the molecular formula C35H37BN4O3 and a molecular weight of 572.52 g/mol.
| Compound Name | CID 173484664 |
|---|---|
| PubChem CID | 173484664 |
| Molecular Formula | C35H37BN4O3 |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\NC([B])=O)c1ccccc1-c1ccc(Cc2c(CCCC)nc(C)n(-c3ccc4c(c3)CCC(C)(C)O4)c2=O)cc1 |
| InChI | InChI=1S/C35H37BN4O3/c1-5-6-11-30-29(20-23-12-14-24(15-13-23)27-9-7-8-10-28(27)32(37)39-34(36)42)33(41)40(22(2)38-30)26-16-17-31-25(21-26)18-19-35(3,4)43-31/h7-10,12-17,21H,5-6,11,18-20H2,1-4H3,(H2,37,39,42) |
| InChIKey | LELYJHIZDDWZPJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|